C33H33BrFN5O3S — CID 144766388
acetylene;(5-bromoimidazo[1,2-a]pyridin-2-yl)-piperidin-1-ylmethanone;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 144766388) has the molecular formula C33H33BrFN5O3S and a molecular weight of 678.63 g/mol. Its IUPAC name is acetylene;(5-bromoimidazo[1,2-a]pyridin-2-yl)-piperidin-1-ylmethanone;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | acetylene;(5-bromoimidazo[1,2-a]pyridin-2-yl)-piperidin-1-ylmethanone;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144766388 |
| Molecular Formula | C33H33BrFN5O3S |
| Molecular Weight | 678.63 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | acetylene;(5-bromoimidazo[1,2-a]pyridin-2-yl)-piperidin-1-ylmethanone;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | C#C.CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)SC)ccc12.O=C(c1cn2c(Br)cccc2n1)N1CCCCC1 |
| InChI | InChI=1S/C18H17FN2O2S.C13H14BrN3O.C2H2/c1-20-18(22)16-14-9-8-13(21(2)24-3)10-15(14)23-17(16)11-4-6-12(19)7-5-11;14-11-5-4-6-12-15-10(9-17(11)12)13(18)16-7-2-1-3-8-16;1-2/h4-10H,1-3H3,(H,20,22);4-6,9H,1-3,7-8H2;1-2H |
| InChIKey | OIZVZLILMVFZLY-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|