C9H19N3 — CID 144764564
7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,4-c]azepin-7-amine (PubChem CID 144764564) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,4-c]azepin-7-amine.
| Compound Name | 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,4-c]azepin-7-amine |
|---|---|
| PubChem CID | 144764564 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,4-c]azepin-7-amine |
| SMILES | CC1(N)CNCC2CNCC2C1 |
| InChI | InChI=1S/C9H19N3/c1-9(10)2-7-3-11-4-8(7)5-12-6-9/h7-8,11-12H,2-6,10H2,1H3 |
| InChIKey | XGKSGWSLYBJHIT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |