C21H17N9O3 — CID 144765721
6-[hydroxy-(pyridin-4-ylamino)methyl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-dicarboxamide (PubChem CID 144765721) has the molecular formula C21H17N9O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 6-[hydroxy-(pyridin-4-ylamino)methyl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-dicarboxamide.
| Compound Name | 6-[hydroxy-(pyridin-4-ylamino)methyl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 144765721 |
| Molecular Formula | C21H17N9O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-[hydroxy-(pyridin-4-ylamino)methyl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-dicarboxamide |
| SMILES | O=C(Nc1ccncc1)c1nc(C(=O)Nc2ccncc2)nc(C(O)Nc2ccncc2)n1 |
| InChI | InChI=1S/C21H17N9O3/c31-19(25-13-1-7-22-8-2-13)16-28-17(20(32)26-14-3-9-23-10-4-14)30-18(29-16)21(33)27-15-5-11-24-12-6-15/h1-12,19,31H,(H,22,25)(H,23,26,32)(H,24,27,33) |
| InChIKey | BVTYPBZLMMGASO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 167.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|