C13H30N4O2 — CID 144767383
4-amino-N'-(3-amino-2,2-dimethylpropoxy)-4-methylheptanehydrazide (PubChem CID 144767383) has the molecular formula C13H30N4O2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-amino-N'-(3-amino-2,2-dimethylpropoxy)-4-methylheptanehydrazide.
| Compound Name | 4-amino-N'-(3-amino-2,2-dimethylpropoxy)-4-methylheptanehydrazide |
|---|---|
| PubChem CID | 144767383 |
| Molecular Formula | C13H30N4O2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 4-amino-N'-(3-amino-2,2-dimethylpropoxy)-4-methylheptanehydrazide |
| SMILES | CCCC(C)(N)CCC(=O)NNOCC(C)(C)CN |
| InChI | InChI=1S/C13H30N4O2/c1-5-7-13(4,15)8-6-11(18)16-17-19-10-12(2,3)9-14/h17H,5-10,14-15H2,1-4H3,(H,16,18) |
| InChIKey | XUCKHIZJYRKOGO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|