C13H27BN2O2 — CID 162756197
CID 162756197 (PubChem CID 162756197) has the molecular formula C13H27BN2O2 and a molecular weight of 254.18 g/mol.
| Compound Name | CID 162756197 |
|---|---|
| PubChem CID | 162756197 |
| Molecular Formula | C13H27BN2O2 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | — |
| SMILES | [B]C(C)(CNC(=O)CCC)COCC(C)(C)CN |
| InChI | InChI=1S/C13H27BN2O2/c1-5-6-11(17)16-8-13(4,14)10-18-9-12(2,3)7-15/h5-10,15H2,1-4H3,(H,16,17) |
| InChIKey | NLTLVXKPCRSJMK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|