C22H43N3O4 — CID 170966316
N-[2-[[3-[3-(butanoylamino)-2,2-dimethylpropoxy]-2,2-dimethylpropyl]amino]-2-oxoethyl]hexanamide (PubChem CID 170966316) has the molecular formula C22H43N3O4 and a molecular weight of 413.60 g/mol. Its IUPAC name is N-[2-[[3-[3-(butanoylamino)-2,2-dimethylpropoxy]-2,2-dimethylpropyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | N-[2-[[3-[3-(butanoylamino)-2,2-dimethylpropoxy]-2,2-dimethylpropyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 170966316 |
| Molecular Formula | C22H43N3O4 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | N-[2-[[3-[3-(butanoylamino)-2,2-dimethylpropoxy]-2,2-dimethylpropyl]amino]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)NCC(=O)NCC(C)(C)COCC(C)(C)CNC(=O)CCC |
| InChI | InChI=1S/C22H43N3O4/c1-7-9-10-12-19(27)23-13-20(28)25-15-22(5,6)17-29-16-21(3,4)14-24-18(26)11-8-2/h7-17H2,1-6H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | BNXBSIYDMWKXJS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|