About 2-cyclohexyloxy-N'-ethylacetohydrazide
2-cyclohexyloxy-N'-ethylacetohydrazide (PubChem CID 144767495) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-cyclohexyloxy-N'-ethylacetohydrazide.
Molecular Properties
| Compound Name | 2-cyclohexyloxy-N'-ethylacetohydrazide |
| PubChem CID | 144767495 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-cyclohexyloxy-N'-ethylacetohydrazide |
| SMILES | CCNNC(=O)COC1CCCCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-2-11-12-10(13)8-14-9-6-4-3-5-7-9/h9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | SOUIJTRUFNFHMH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyloxy-N'-ethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxy-N'-ethylacetohydrazide?
The IUPAC name of 2-cyclohexyloxy-N'-ethylacetohydrazide (CID 144767495) is 2-cyclohexyloxy-N'-ethylacetohydrazide.
What is the SMILES notation for 2-cyclohexyloxy-N'-ethylacetohydrazide?
The canonical SMILES for 2-cyclohexyloxy-N'-ethylacetohydrazide is CCNNC(=O)COC1CCCCC1.
What is the InChIKey of 2-cyclohexyloxy-N'-ethylacetohydrazide?
The InChIKey is SOUIJTRUFNFHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-2-11-12-10(13)8-14-9-6-4-3-5-7-9/h9,11H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-cyclohexyloxy-N'-ethylacetohydrazide?
2-cyclohexyloxy-N'-ethylacetohydrazide has a molecular weight of 200.28 g/mol, XLogP of 0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxy-N'-ethylacetohydrazide is sourced from PubChem (CID 144767495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).