About cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate
cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate (PubChem CID 144767676) has the molecular formula C15H16INO3S
and a molecular weight of 417.27 g/mol. Its IUPAC name is cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate.
Molecular Properties
| Compound Name | cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate |
| PubChem CID | 144767676 |
| Molecular Formula | C15H16INO3S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate |
| SMILES | COC(=O)c1cccc2ccn(SI)c12.O=C1CCCC1 |
| InChI | InChI=1S/C10H8INO2S.C5H8O/c1-14-10(13)8-4-2-3-7-5-6-12(15-11)9(7)8;6-5-3-1-2-4-5/h2-6H,1H3;1-4H2 |
| InChIKey | MKLJNWVQTVLOHU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate?
The IUPAC name of cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate (CID 144767676) is cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate.
What is the SMILES notation for cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate?
The canonical SMILES for cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate is COC(=O)c1cccc2ccn(SI)c12.O=C1CCCC1.
What is the InChIKey of cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate?
The InChIKey is MKLJNWVQTVLOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8INO2S.C5H8O/c1-14-10(13)8-4-2-3-7-5-6-12(15-11)9(7)8;6-5-3-1-2-4-5/h2-6H,1H3;1-4H2.
What are the key properties of cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate?
cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate has a molecular weight of 417.27 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanone;methyl 1-iodosulfanylindole-7-carboxylate is sourced from PubChem (CID 144767676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).