C10H18O — CID 144768064
(2S,3S)-2-methyl-3-pent-4-en-2-yloxolane (PubChem CID 144768064) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-pent-4-en-2-yloxolane.
| Compound Name | (2S,3S)-2-methyl-3-pent-4-en-2-yloxolane |
|---|---|
| PubChem CID | 144768064 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2S,3S)-2-methyl-3-pent-4-en-2-yloxolane |
| SMILES | C=CCC(C)[C@@H]1CCO[C@H]1C |
| InChI | InChI=1S/C10H18O/c1-4-5-8(2)10-6-7-11-9(10)3/h4,8-10H,1,5-7H2,2-3H3/t8?,9-,10-/m0/s1 |
| InChIKey | RXGZOSPPYRSDDP-AGROOBSYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|