C34H30ClN3 — CID 144769458
7-chloro-3-[(Z)-hex-4-en-3-yl]-2-[4-(4-naphthalen-1-ylphenyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine (PubChem CID 144769458) has the molecular formula C34H30ClN3 and a molecular weight of 516.09 g/mol. Its IUPAC name is 7-chloro-3-[(Z)-hex-4-en-3-yl]-2-[4-(4-naphthalen-1-ylphenyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine.
| Compound Name | 7-chloro-3-[(Z)-hex-4-en-3-yl]-2-[4-(4-naphthalen-1-ylphenyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 144769458 |
| Molecular Formula | C34H30ClN3 |
| Molecular Weight | 516.09 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 7-chloro-3-[(Z)-hex-4-en-3-yl]-2-[4-(4-naphthalen-1-ylphenyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine |
| SMILES | C/C=C\C(CC)N1c2nccc(Cl)c2NC1c1ccc(-c2ccc(-c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C34H30ClN3/c1-3-8-28(4-2)38-33(37-32-31(35)21-22-36-34(32)38)27-19-15-24(16-20-27)23-13-17-26(18-14-23)30-12-7-10-25-9-5-6-11-29(25)30/h3,5-22,28,33,37H,4H2,1-2H3/b8-3- |
| InChIKey | WNQWDHGRRJACKK-BAQGIRSFSA-N |
| XLogP | 9.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.09 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|