C17H38N2O2 — CID 144770393
tert-butyl N-ethyl-N-[(4-methylpyrrolidin-3-yl)methyl]carbamate;ethane (PubChem CID 144770393) has the molecular formula C17H38N2O2 and a molecular weight of 302.50 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(4-methylpyrrolidin-3-yl)methyl]carbamate;ethane.
| Compound Name | tert-butyl N-ethyl-N-[(4-methylpyrrolidin-3-yl)methyl]carbamate;ethane |
|---|---|
| PubChem CID | 144770393 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | tert-butyl N-ethyl-N-[(4-methylpyrrolidin-3-yl)methyl]carbamate;ethane |
| SMILES | CC.CC.CCN(CC1CNCC1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N2O2.2C2H6/c1-6-15(12(16)17-13(3,4)5)9-11-8-14-7-10(11)2;2*1-2/h10-11,14H,6-9H2,1-5H3;2*1-2H3 |
| InChIKey | LHDSTAGHDNOUIO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |