C26H47NO7S — CID 144772191
2-[[1-hydroxy-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentyl]amino]ethanesulfonic acid (PubChem CID 144772191) has the molecular formula C26H47NO7S and a molecular weight of 517.73 g/mol. Its IUPAC name is 2-[[1-hydroxy-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[1-hydroxy-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 144772191 |
| Molecular Formula | C26H47NO7S |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 2-[[1-hydroxy-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentyl]amino]ethanesulfonic acid |
| SMILES | CC(CCC(O)NCCS(=O)(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C26H47NO7S/c1-15(4-7-23(31)27-10-11-35(32,33)34)18-5-6-19-24-20(14-22(30)26(18,19)3)25(2)9-8-17(28)12-16(25)13-21(24)29/h15-24,27-31H,4-14H2,1-3H3,(H,32,33,34) |
| InChIKey | BRHPUTQXZRMWAE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|