C27H49NO6S — CID 78146477
3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]propane-1-sulfonic acid (PubChem CID 78146477) has the molecular formula C27H49NO6S and a molecular weight of 515.76 g/mol. Its IUPAC name is 3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]propane-1-sulfonic acid.
| Compound Name | 3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 78146477 |
| Molecular Formula | C27H49NO6S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]propane-1-sulfonic acid |
| SMILES | CC(CCCNCCCS(=O)(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C27H49NO6S/c1-17(6-4-11-28-12-5-13-35(32,33)34)20-7-8-21-25-22(16-24(31)27(20,21)3)26(2)10-9-19(29)14-18(26)15-23(25)30/h17-25,28-31H,4-16H2,1-3H3,(H,32,33,34) |
| InChIKey | DVMQBKMQYGNHGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|