C18H24ClF3N4OS — CID 144772530
ethane;methyl 5-chloro-N-methyl-2-(2-methylpiperazin-1-yl)-4-(trifluoromethyl)-1,3-benzoxazole-7-carboximidothioate (PubChem CID 144772530) has the molecular formula C18H24ClF3N4OS and a molecular weight of 436.93 g/mol. Its IUPAC name is ethane;methyl 5-chloro-N-methyl-2-(2-methylpiperazin-1-yl)-4-(trifluoromethyl)-1,3-benzoxazole-7-carboximidothioate.
| Compound Name | ethane;methyl 5-chloro-N-methyl-2-(2-methylpiperazin-1-yl)-4-(trifluoromethyl)-1,3-benzoxazole-7-carboximidothioate |
|---|---|
| PubChem CID | 144772530 |
| Molecular Formula | C18H24ClF3N4OS |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | ethane;methyl 5-chloro-N-methyl-2-(2-methylpiperazin-1-yl)-4-(trifluoromethyl)-1,3-benzoxazole-7-carboximidothioate |
| SMILES | C/N=C(\SC)c1cc(Cl)c(C(F)(F)F)c2nc(N3CCNCC3C)oc12.CC |
| InChI | InChI=1S/C16H18ClF3N4OS.C2H6/c1-8-7-22-4-5-24(8)15-23-12-11(16(18,19)20)10(17)6-9(13(12)25-15)14(21-2)26-3;1-2/h6,8,22H,4-5,7H2,1-3H3;1-2H3/b21-14-; |
| InChIKey | FAKVLCJHQZOYMC-UXTSPRGOSA-N |
| XLogP | 5.06 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|