About 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole
5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole (PubChem CID 121331050) has the molecular formula C13H16ClN3O3S
and a molecular weight of 329.81 g/mol. Its IUPAC name is 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole |
| PubChem CID | 121331050 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole |
| SMILES | CC1CNCCN1c1nc2cc(Cl)cc(S(C)(=O)=O)c2o1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-8-7-15-3-4-17(8)13-16-10-5-9(14)6-11(12(10)20-13)21(2,18)19/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | IBJRTCKJQULBPH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole?
The IUPAC name of 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole (CID 121331050) is 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole.
What is the SMILES notation for 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole?
The canonical SMILES for 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole is CC1CNCCN1c1nc2cc(Cl)cc(S(C)(=O)=O)c2o1.
What is the InChIKey of 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole?
The InChIKey is IBJRTCKJQULBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O3S/c1-8-7-15-3-4-17(8)13-16-10-5-9(14)6-11(12(10)20-13)21(2,18)19/h5-6,8,15H,3-4,7H2,1-2H3.
What are the key properties of 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole?
5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole has a molecular weight of 329.81 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole is sourced from PubChem (CID 121331050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).