C13H16ClN3O3S — CID 121331050
5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole (PubChem CID 121331050) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 121331050 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-chloro-2-(2-methylpiperazin-1-yl)-7-methylsulfonyl-1,3-benzoxazole |
| SMILES | CC1CNCCN1c1nc2cc(Cl)cc(S(C)(=O)=O)c2o1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-8-7-15-3-4-17(8)13-16-10-5-9(14)6-11(12(10)20-13)21(2,18)19/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | IBJRTCKJQULBPH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |