C21H22F2N4O2S — CID 160591467
5-fluoro-7-methyl-3H-1,3-benzoxazole-2-thione;5-fluoro-7-methyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole (PubChem CID 160591467) has the molecular formula C21H22F2N4O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is 5-fluoro-7-methyl-3H-1,3-benzoxazole-2-thione;5-fluoro-7-methyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 5-fluoro-7-methyl-3H-1,3-benzoxazole-2-thione;5-fluoro-7-methyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 160591467 |
| Molecular Formula | C21H22F2N4O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-fluoro-7-methyl-3H-1,3-benzoxazole-2-thione;5-fluoro-7-methyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole |
| SMILES | Cc1cc(F)cc2[nH]c(=S)oc12.Cc1cc(F)cc2nc(N3CCNC[C@@H]3C)oc12 |
| InChI | InChI=1S/C13H16FN3O.C8H6FNOS/c1-8-5-10(14)6-11-12(8)18-13(16-11)17-4-3-15-7-9(17)2;1-4-2-5(9)3-6-7(4)11-8(12)10-6/h5-6,9,15H,3-4,7H2,1-2H3;2-3H,1H3,(H,10,12)/t9-;/m0./s1 |
| InChIKey | RDBQPWNOJRYXSH-FVGYRXGTSA-N |
| XLogP | 5.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|