C23H26Cl2N4O2S — CID 160502135
5-chloro-7-ethyl-3H-1,3-benzoxazole-2-thione;5-chloro-7-ethyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole (PubChem CID 160502135) has the molecular formula C23H26Cl2N4O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is 5-chloro-7-ethyl-3H-1,3-benzoxazole-2-thione;5-chloro-7-ethyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 5-chloro-7-ethyl-3H-1,3-benzoxazole-2-thione;5-chloro-7-ethyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 160502135 |
| Molecular Formula | C23H26Cl2N4O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 5-chloro-7-ethyl-3H-1,3-benzoxazole-2-thione;5-chloro-7-ethyl-2-[(2S)-2-methylpiperazin-1-yl]-1,3-benzoxazole |
| SMILES | CCc1cc(Cl)cc2[nH]c(=S)oc12.CCc1cc(Cl)cc2nc(N3CCNC[C@@H]3C)oc12 |
| InChI | InChI=1S/C14H18ClN3O.C9H8ClNOS/c1-3-10-6-11(15)7-12-13(10)19-14(17-12)18-5-4-16-8-9(18)2;1-2-5-3-6(10)4-7-8(5)12-9(13)11-7/h6-7,9,16H,3-5,8H2,1-2H3;3-4H,2H2,1H3,(H,11,13)/t9-;/m0./s1 |
| InChIKey | QRXSJACHDYJIIH-FVGYRXGTSA-N |
| XLogP | 6.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|