C44H29N4- — CID 144775562
6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenanthren-9-ylphenyl]-1H-isoquinolin-2-ide (PubChem CID 144775562) has the molecular formula C44H29N4- and a molecular weight of 613.74 g/mol. Its IUPAC name is 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenanthren-9-ylphenyl]-1H-isoquinolin-2-ide.
| Compound Name | 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenanthren-9-ylphenyl]-1H-isoquinolin-2-ide |
|---|---|
| PubChem CID | 144775562 |
| Molecular Formula | C44H29N4- |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenanthren-9-ylphenyl]-1H-isoquinolin-2-ide |
| SMILES | C1=Cc2cc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4cc5ccccc5c5ccccc45)c3)ccc2C[N-]1 |
| InChI | InChI=1S/C44H29N4/c1-3-11-29(12-4-1)42-46-43(30-13-5-2-6-14-30)48-44(47-42)37-25-35(31-19-20-34-28-45-22-21-32(34)23-31)24-36(26-37)41-27-33-15-7-8-16-38(33)39-17-9-10-18-40(39)41/h1-27H,28H2/q-1 |
| InChIKey | FDEABSIWOTUTIJ-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 52.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|