C38H23N4O- — CID 163753916
10-(4-phenanthren-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1H-[1]benzofuro[2,3-g]isoquinolin-2-ide (PubChem CID 163753916) has the molecular formula C38H23N4O- and a molecular weight of 551.63 g/mol. Its IUPAC name is 10-(4-phenanthren-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1H-[1]benzofuro[2,3-g]isoquinolin-2-ide.
| Compound Name | 10-(4-phenanthren-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1H-[1]benzofuro[2,3-g]isoquinolin-2-ide |
|---|---|
| PubChem CID | 163753916 |
| Molecular Formula | C38H23N4O- |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 10-(4-phenanthren-2-yl-6-phenyl-1,3,5-triazin-2-yl)-1H-[1]benzofuro[2,3-g]isoquinolin-2-ide |
| SMILES | C1=Cc2cc3oc4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7c(ccc8ccccc87)c6)n5)c4c3cc2C[N-]1 |
| InChI | InChI=1S/C38H23N4O/c1-2-8-24(9-3-1)36-40-37(27-15-16-30-26(19-27)14-13-23-7-4-5-10-29(23)30)42-38(41-36)31-11-6-12-33-35(31)32-20-28-22-39-18-17-25(28)21-34(32)43-33/h1-21H,22H2/q-1 |
| InChIKey | LSJUNRQPDKFSHH-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|