C21H23N — CID 144775880
(E)-4-[3-[(3,4-dimethylphenyl)methyl]phenyl]-N-methylpent-3-en-1-yn-3-amine (PubChem CID 144775880) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-4-[3-[(3,4-dimethylphenyl)methyl]phenyl]-N-methylpent-3-en-1-yn-3-amine.
| Compound Name | (E)-4-[3-[(3,4-dimethylphenyl)methyl]phenyl]-N-methylpent-3-en-1-yn-3-amine |
|---|---|
| PubChem CID | 144775880 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-4-[3-[(3,4-dimethylphenyl)methyl]phenyl]-N-methylpent-3-en-1-yn-3-amine |
| SMILES | C#C/C(NC)=C(/C)c1cccc(Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C21H23N/c1-6-21(22-5)17(4)20-9-7-8-18(14-20)13-19-11-10-15(2)16(3)12-19/h1,7-12,14,22H,13H2,2-5H3/b21-17+ |
| InChIKey | AVTCPFLGWBZJOI-HEHNFIMWSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|