About 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone
1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone (PubChem CID 144777077) has the molecular formula C26H38O
and a molecular weight of 366.59 g/mol. Its IUPAC name is 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone |
| PubChem CID | 144777077 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone |
| SMILES | C/C=C\c1ccc(C(C)=O)cc1C.CC.CCc1cc(CC)c(C)cc1C |
| InChI | InChI=1S/C12H14O.C12H18.C2H6/c1-4-5-11-6-7-12(10(3)13)8-9(11)2;1-5-11-8-12(6-2)10(4)7-9(11)3;1-2/h4-8H,1-3H3;7-8H,5-6H2,1-4H3;1-2H3/b5-4-;; |
| InChIKey | WNCMFWMXNQTRCP-WNCVTPEDSA-N |
| XLogP | 7.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone?
The IUPAC name of 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone (CID 144777077) is 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone.
What is the SMILES notation for 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone?
The canonical SMILES for 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone is C/C=C\c1ccc(C(C)=O)cc1C.CC.CCc1cc(CC)c(C)cc1C.
What is the InChIKey of 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone?
The InChIKey is WNCMFWMXNQTRCP-WNCVTPEDSA-N. The full InChI is InChI=1S/C12H14O.C12H18.C2H6/c1-4-5-11-6-7-12(10(3)13)8-9(11)2;1-5-11-8-12(6-2)10(4)7-9(11)3;1-2/h4-8H,1-3H3;7-8H,5-6H2,1-4H3;1-2H3/b5-4-;;.
What are the key properties of 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone?
1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone has a molecular weight of 366.59 g/mol, XLogP of 7.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethyl-2,4-dimethylbenzene;ethane;1-[3-methyl-4-[(Z)-prop-1-enyl]phenyl]ethanone is sourced from PubChem (CID 144777077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).