C14H20N2O3 — CID 144778443
3-[ethyl-[(2R,4S)-4-hydroxyoxolan-2-yl]amino]-2-methylbenzamide (PubChem CID 144778443) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-[ethyl-[(2R,4S)-4-hydroxyoxolan-2-yl]amino]-2-methylbenzamide.
| Compound Name | 3-[ethyl-[(2R,4S)-4-hydroxyoxolan-2-yl]amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 144778443 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[ethyl-[(2R,4S)-4-hydroxyoxolan-2-yl]amino]-2-methylbenzamide |
| SMILES | CCN(c1cccc(C(N)=O)c1C)[C@H]1C[C@H](O)CO1 |
| InChI | InChI=1S/C14H20N2O3/c1-3-16(13-7-10(17)8-19-13)12-6-4-5-11(9(12)2)14(15)18/h4-6,10,13,17H,3,7-8H2,1-2H3,(H2,15,18)/t10-,13+/m0/s1 |
| InChIKey | DNBNGPNZEXGUIC-GXFFZTMASA-N |
| XLogP | 1.03 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |