C24H37NO2 — CID 144778571
acetylene;2-ethoxy-11-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 144778571) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is acetylene;2-ethoxy-11-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | acetylene;2-ethoxy-11-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 144778571 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | acetylene;2-ethoxy-11-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C#C.CCOC1CCC2CCC3C4CCC(C#N)C4(C)CC(O)C3C2(C)C1 |
| InChI | InChI=1S/C22H35NO2.C2H2/c1-4-25-16-8-5-14-6-9-17-18-10-7-15(13-23)21(18,2)12-19(24)20(17)22(14,3)11-16;1-2/h14-20,24H,4-12H2,1-3H3;1-2H |
| InChIKey | NVIQAORNOQGIJW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|