C20H33NO4 — CID 145316196
(10S)-2-methoxy-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-ol (PubChem CID 145316196) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (10S)-2-methoxy-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (10S)-2-methoxy-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 145316196 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (10S)-2-methoxy-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-ol |
| SMILES | COC1CCC2CCC3C4CCC([N+](=O)[O-])C4(C)CC(O)C3[C@@]2(C)C1 |
| InChI | InChI=1S/C20H33NO4/c1-19-10-13(25-3)6-4-12(19)5-7-14-15-8-9-17(21(23)24)20(15,2)11-16(22)18(14)19/h12-18,22H,4-11H2,1-3H3/t12?,13?,14?,15?,16?,17?,18?,19-,20?/m0/s1 |
| InChIKey | XYFXXFXJCCULNS-KEQVZBPBSA-N |
| XLogP | 3.66 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|