C19H33ClN2O2 — CID 67088426
(8R,9R,10S,13S,14S)-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine;hydrochloride (PubChem CID 67088426) has the molecular formula C19H33ClN2O2 and a molecular weight of 356.94 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine;hydrochloride.
| Compound Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine;hydrochloride |
|---|---|
| PubChem CID | 67088426 |
| Molecular Formula | C19H33ClN2O2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-17-nitro-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine;hydrochloride |
| SMILES | C[C@]12CCC(N)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C([N+](=O)[O-])CC[C@@H]12.Cl |
| InChI | InChI=1S/C19H32N2O2.ClH/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21(22)23)19(15,2)10-8-16(14)18;/h12-17H,3-11,20H2,1-2H3;1H/t12?,13?,14-,15-,16+,17?,18-,19-;/m0./s1 |
| InChIKey | OMRAXLPPNMXRQD-BWQBKWEJSA-N |
| XLogP | 4.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|