C11H22N4O3 — CID 144778806
methanamine;N-[[2-(2-methoxyethyl)-3-methyl-5-oxo-1H-pyrazol-4-yl]methyl]acetamide (PubChem CID 144778806) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is methanamine;N-[[2-(2-methoxyethyl)-3-methyl-5-oxo-1H-pyrazol-4-yl]methyl]acetamide.
| Compound Name | methanamine;N-[[2-(2-methoxyethyl)-3-methyl-5-oxo-1H-pyrazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 144778806 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | methanamine;N-[[2-(2-methoxyethyl)-3-methyl-5-oxo-1H-pyrazol-4-yl]methyl]acetamide |
| SMILES | CN.COCCn1[nH]c(=O)c(CNC(C)=O)c1C |
| InChI | InChI=1S/C10H17N3O3.CH5N/c1-7-9(6-11-8(2)14)10(15)12-13(7)4-5-16-3;1-2/h4-6H2,1-3H3,(H,11,14)(H,12,15);2H2,1H3 |
| InChIKey | VNYZCVDCLGQCOB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |