C30H30F3N7O4 — CID 144779466
N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-nitrosoanilino)-2-(2-methylphenyl)acetamide;2-(3-hydroxy-2-oxopyrrolidin-1-yl)pyrimidine-4-carbonitrile (PubChem CID 144779466) has the molecular formula C30H30F3N7O4 and a molecular weight of 609.61 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-nitrosoanilino)-2-(2-methylphenyl)acetamide;2-(3-hydroxy-2-oxopyrrolidin-1-yl)pyrimidine-4-carbonitrile.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-nitrosoanilino)-2-(2-methylphenyl)acetamide;2-(3-hydroxy-2-oxopyrrolidin-1-yl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 144779466 |
| Molecular Formula | C30H30F3N7O4 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-nitrosoanilino)-2-(2-methylphenyl)acetamide;2-(3-hydroxy-2-oxopyrrolidin-1-yl)pyrimidine-4-carbonitrile |
| SMILES | Cc1ccccc1C(C(=O)NC1CCC(F)(F)CC1)N(N=O)c1cccc(F)c1.N#Cc1ccnc(N2CCC(O)C2=O)n1 |
| InChI | InChI=1S/C21H22F3N3O2.C9H8N4O2/c1-14-5-2-3-8-18(14)19(27(26-29)17-7-4-6-15(22)13-17)20(28)25-16-9-11-21(23,24)12-10-16;10-5-6-1-3-11-9(12-6)13-4-2-7(14)8(13)15/h2-8,13,16,19H,9-12H2,1H3,(H,25,28);1,3,7,14H,2,4H2 |
| InChIKey | LNVYVFOTNJYUDO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|