C28H30F4N4O2 — CID 162592362
N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-[2-[(2-fluoro-3-pyridinyl)amino]-1-hydroxyethyl]anilino)-2-(2-methylphenyl)acetamide (PubChem CID 162592362) has the molecular formula C28H30F4N4O2 and a molecular weight of 530.57 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-[2-[(2-fluoro-3-pyridinyl)amino]-1-hydroxyethyl]anilino)-2-(2-methylphenyl)acetamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-[2-[(2-fluoro-3-pyridinyl)amino]-1-hydroxyethyl]anilino)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 162592362 |
| Molecular Formula | C28H30F4N4O2 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(3-fluoro-N-[2-[(2-fluoro-3-pyridinyl)amino]-1-hydroxyethyl]anilino)-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1C(C(=O)NC1CCC(F)(F)CC1)N(c1cccc(F)c1)C(O)CNc1cccnc1F |
| InChI | InChI=1S/C28H30F4N4O2/c1-18-6-2-3-9-22(18)25(27(38)35-20-11-13-28(31,32)14-12-20)36(21-8-4-7-19(29)16-21)24(37)17-34-23-10-5-15-33-26(23)30/h2-10,15-16,20,24-25,34,37H,11-14,17H2,1H3,(H,35,38) |
| InChIKey | JDLYCGHYUCYEBK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|