About 1-amino-8,8-dimethyl-3H-purine-2,6-dione
1-amino-8,8-dimethyl-3H-purine-2,6-dione (PubChem CID 144780164) has the molecular formula C7H9N5O2
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-amino-8,8-dimethyl-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1-amino-8,8-dimethyl-3H-purine-2,6-dione |
| PubChem CID | 144780164 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-amino-8,8-dimethyl-3H-purine-2,6-dione |
| SMILES | CC1(C)N=c2[nH]c(=O)n(N)c(=O)c2=N1 |
| InChI | InChI=1S/C7H9N5O2/c1-7(2)10-3-4(11-7)9-6(14)12(8)5(3)13/h8H2,1-2H3,(H,9,11,14) |
| InChIKey | OVFKFAAERMIPHN-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-amino-8,8-dimethyl-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-8,8-dimethyl-3H-purine-2,6-dione?
The IUPAC name of 1-amino-8,8-dimethyl-3H-purine-2,6-dione (CID 144780164) is 1-amino-8,8-dimethyl-3H-purine-2,6-dione.
What is the SMILES notation for 1-amino-8,8-dimethyl-3H-purine-2,6-dione?
The canonical SMILES for 1-amino-8,8-dimethyl-3H-purine-2,6-dione is CC1(C)N=c2[nH]c(=O)n(N)c(=O)c2=N1.
What is the InChIKey of 1-amino-8,8-dimethyl-3H-purine-2,6-dione?
The InChIKey is OVFKFAAERMIPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O2/c1-7(2)10-3-4(11-7)9-6(14)12(8)5(3)13/h8H2,1-2H3,(H,9,11,14).
What are the key properties of 1-amino-8,8-dimethyl-3H-purine-2,6-dione?
1-amino-8,8-dimethyl-3H-purine-2,6-dione has a molecular weight of 195.18 g/mol, XLogP of -2.76, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-8,8-dimethyl-3H-purine-2,6-dione is sourced from PubChem (CID 144780164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).