C9H12N4O2 — CID 150069526
8,8-diethyl-3H-purine-2,6-dione (PubChem CID 150069526) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 8,8-diethyl-3H-purine-2,6-dione.
| Compound Name | 8,8-diethyl-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 150069526 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 8,8-diethyl-3H-purine-2,6-dione |
| SMILES | CCC1(CC)N=c2[nH]c(=O)[nH]c(=O)c2=N1 |
| InChI | InChI=1S/C9H12N4O2/c1-3-9(4-2)12-5-6(13-9)10-8(15)11-7(5)14/h3-4H2,1-2H3,(H2,10,11,13,14,15) |
| InChIKey | DOYYRHKIBSHBDP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |