C22H30ClFN4O — CID 144782264
(Z)-2-[4-(4-chloro-2-fluorophenyl)phenyl]-2-hydrazinylethenamine;cyclopentane;propanamide (PubChem CID 144782264) has the molecular formula C22H30ClFN4O and a molecular weight of 420.96 g/mol. Its IUPAC name is (Z)-2-[4-(4-chloro-2-fluorophenyl)phenyl]-2-hydrazinylethenamine;cyclopentane;propanamide.
| Compound Name | (Z)-2-[4-(4-chloro-2-fluorophenyl)phenyl]-2-hydrazinylethenamine;cyclopentane;propanamide |
|---|---|
| PubChem CID | 144782264 |
| Molecular Formula | C22H30ClFN4O |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (Z)-2-[4-(4-chloro-2-fluorophenyl)phenyl]-2-hydrazinylethenamine;cyclopentane;propanamide |
| SMILES | C1CCCC1.CCC(N)=O.N/C=C(\NN)c1ccc(-c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C14H13ClFN3.C5H10.C3H7NO/c15-11-5-6-12(13(16)7-11)9-1-3-10(4-2-9)14(8-17)19-18;1-2-4-5-3-1;1-2-3(4)5/h1-8,19H,17-18H2;1-5H2;2H2,1H3,(H2,4,5)/b14-8-;; |
| InChIKey | ANXNFOHIHUKGAC-KPHFHJPJSA-N |
| XLogP | 4.70 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|