C29H34N4O — CID 144782777
(E)-3-methyl-2-(2-methylidene-1-pyridinyl)-N-[[4-(4-phenylpiperazin-1-yl)phenyl]methyl]pent-2-enamide (PubChem CID 144782777) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is (E)-3-methyl-2-(2-methylidene-1-pyridinyl)-N-[[4-(4-phenylpiperazin-1-yl)phenyl]methyl]pent-2-enamide.
| Compound Name | (E)-3-methyl-2-(2-methylidene-1-pyridinyl)-N-[[4-(4-phenylpiperazin-1-yl)phenyl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 144782777 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (E)-3-methyl-2-(2-methylidene-1-pyridinyl)-N-[[4-(4-phenylpiperazin-1-yl)phenyl]methyl]pent-2-enamide |
| SMILES | C=C1C=CC=CN1/C(C(=O)NCc1ccc(N2CCN(c3ccccc3)CC2)cc1)=C(\C)CC |
| InChI | InChI=1S/C29H34N4O/c1-4-23(2)28(33-17-9-8-10-24(33)3)29(34)30-22-25-13-15-27(16-14-25)32-20-18-31(19-21-32)26-11-6-5-7-12-26/h5-17H,3-4,18-22H2,1-2H3,(H,30,34)/b28-23+ |
| InChIKey | PITNDVPDKANRGG-WEMUOSSPSA-N |
| XLogP | 5.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|