C26H46N2O2 — CID 144783257
(4E,9Z,10Z)-7-(dimethylamino)-7-ethyl-2-[ethyl(2-methoxyethyl)amino]-5-methyl-9-prop-2-enylidenetrideca-4,10-dien-6-one (PubChem CID 144783257) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is (4E,9Z,10Z)-7-(dimethylamino)-7-ethyl-2-[ethyl(2-methoxyethyl)amino]-5-methyl-9-prop-2-enylidenetrideca-4,10-dien-6-one.
| Compound Name | (4E,9Z,10Z)-7-(dimethylamino)-7-ethyl-2-[ethyl(2-methoxyethyl)amino]-5-methyl-9-prop-2-enylidenetrideca-4,10-dien-6-one |
|---|---|
| PubChem CID | 144783257 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | (4E,9Z,10Z)-7-(dimethylamino)-7-ethyl-2-[ethyl(2-methoxyethyl)amino]-5-methyl-9-prop-2-enylidenetrideca-4,10-dien-6-one |
| SMILES | C=C/C=C(\C=C/CC)CC(CC)(C(=O)/C(C)=C/CC(C)N(CC)CCOC)N(C)C |
| InChI | InChI=1S/C26H46N2O2/c1-10-14-16-24(15-11-2)21-26(12-3,27(7)8)25(29)22(5)17-18-23(6)28(13-4)19-20-30-9/h11,14-17,23H,2,10,12-13,18-21H2,1,3-9H3/b16-14-,22-17+,24-15+ |
| InChIKey | NLJFKOQLDDYOLW-PDWYCMGZSA-N |
| XLogP | 5.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|