C14H13F3N4O3 — CID 144784203
1-amino-3-[3-(difluoromethoxy)-2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]urea (PubChem CID 144784203) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-amino-3-[3-(difluoromethoxy)-2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]urea.
| Compound Name | 1-amino-3-[3-(difluoromethoxy)-2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]urea |
|---|---|
| PubChem CID | 144784203 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-amino-3-[3-(difluoromethoxy)-2-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]urea |
| SMILES | NNC(=O)Nc1cccc(OC(F)F)c1COc1cccc(F)n1 |
| InChI | InChI=1S/C14H13F3N4O3/c15-11-5-2-6-12(20-11)23-7-8-9(19-14(22)21-18)3-1-4-10(8)24-13(16)17/h1-6,13H,7,18H2,(H2,19,21,22) |
| InChIKey | XXZKWDSWNNFMTH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|