About tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane
tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane (PubChem CID 144787069) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane.
Molecular Properties
| Compound Name | tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane |
| PubChem CID | 144787069 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane |
| SMILES | C.CC.CC(C)(C)OC(=O)n1ncc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H13N3O4.C2H6.CH4/c1-12(2,3)19-11(16)14-10-5-4-9(15(17)18)6-8(10)7-13-14;1-2;/h4-7H,1-3H3;1-2H3;1H4 |
| InChIKey | ACPBKNGNUCGFAR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane?
The IUPAC name of tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane (CID 144787069) is tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane.
What is the SMILES notation for tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane?
The canonical SMILES for tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane is C.CC.CC(C)(C)OC(=O)n1ncc2cc([N+](=O)[O-])ccc21.
What is the InChIKey of tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane?
The InChIKey is ACPBKNGNUCGFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4.C2H6.CH4/c1-12(2,3)19-11(16)14-10-5-4-9(15(17)18)6-8(10)7-13-14;1-2;/h4-7H,1-3H3;1-2H3;1H4.
What are the key properties of tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane?
tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane has a molecular weight of 309.37 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-nitroindazole-1-carboxylate;ethane;methane is sourced from PubChem (CID 144787069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).