About 2-benzyl-5-nitroindazole
2-benzyl-5-nitroindazole (PubChem CID 4653102) has the molecular formula C14H11N3O2
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-benzyl-5-nitroindazole.
Molecular Properties
| Compound Name | 2-benzyl-5-nitroindazole |
| PubChem CID | 4653102 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-benzyl-5-nitroindazole |
| SMILES | O=[N+]([O-])c1ccc2nn(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C14H11N3O2/c18-17(19)13-6-7-14-12(8-13)10-16(15-14)9-11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | ONOBHKWISLHHCC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-5-nitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-nitroindazole?
The IUPAC name of 2-benzyl-5-nitroindazole (CID 4653102) is 2-benzyl-5-nitroindazole.
What is the SMILES notation for 2-benzyl-5-nitroindazole?
The canonical SMILES for 2-benzyl-5-nitroindazole is O=[N+]([O-])c1ccc2nn(Cc3ccccc3)cc2c1.
What is the InChIKey of 2-benzyl-5-nitroindazole?
The InChIKey is ONOBHKWISLHHCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2/c18-17(19)13-6-7-14-12(8-13)10-16(15-14)9-11-4-2-1-3-5-11/h1-8,10H,9H2.
What are the key properties of 2-benzyl-5-nitroindazole?
2-benzyl-5-nitroindazole has a molecular weight of 253.26 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-nitroindazole is sourced from PubChem (CID 4653102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).