C9H11NO4 — CID 144787090
methyl 2-methyl-5-nitrocyclohexa-1,5-diene-1-carboxylate (PubChem CID 144787090) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 2-methyl-5-nitrocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 2-methyl-5-nitrocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 144787090 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | methyl 2-methyl-5-nitrocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CCC([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C9H11NO4/c1-6-3-4-7(10(12)13)5-8(6)9(11)14-2/h5H,3-4H2,1-2H3 |
| InChIKey | IGEZMNDAKUFJAV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|