C9H10FNO4 — CID 143386813
methyl 5-fluoro-6-nitrocyclohepta-1,6-diene-1-carboxylate (PubChem CID 143386813) has the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. Its IUPAC name is methyl 5-fluoro-6-nitrocyclohepta-1,6-diene-1-carboxylate.
| Compound Name | methyl 5-fluoro-6-nitrocyclohepta-1,6-diene-1-carboxylate |
|---|---|
| PubChem CID | 143386813 |
| Molecular Formula | C9H10FNO4 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | methyl 5-fluoro-6-nitrocyclohepta-1,6-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCCC(F)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C9H10FNO4/c1-15-9(12)6-3-2-4-7(10)8(5-6)11(13)14/h3,5,7H,2,4H2,1H3 |
| InChIKey | FOQLKEYHMXFQCU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|