C10H11F2NO4 — CID 143293851
methyl (2Z,3E)-4-fluoro-2-(2-fluoro-1-nitropropylidene)hexa-3,5-dienoate (PubChem CID 143293851) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is methyl (2Z,3E)-4-fluoro-2-(2-fluoro-1-nitropropylidene)hexa-3,5-dienoate.
| Compound Name | methyl (2Z,3E)-4-fluoro-2-(2-fluoro-1-nitropropylidene)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 143293851 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | methyl (2Z,3E)-4-fluoro-2-(2-fluoro-1-nitropropylidene)hexa-3,5-dienoate |
| SMILES | C=C/C(F)=C\C(C(=O)OC)=C(/C(C)F)[N+](=O)[O-] |
| InChI | InChI=1S/C10H11F2NO4/c1-4-7(12)5-8(10(14)17-3)9(6(2)11)13(15)16/h4-6H,1H2,2-3H3/b7-5+,9-8- |
| InChIKey | OSIPBSHMGDNVBI-WGKMIZOUSA-N |
| XLogP | 2.09 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|