C8H8FNO4 — CID 152508607
methyl 4-fluoro-4-nitrocyclohexa-1,5-diene-1-carboxylate (PubChem CID 152508607) has the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. Its IUPAC name is methyl 4-fluoro-4-nitrocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-fluoro-4-nitrocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 152508607 |
| Molecular Formula | C8H8FNO4 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | methyl 4-fluoro-4-nitrocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(F)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C8H8FNO4/c1-14-7(11)6-2-4-8(9,5-3-6)10(12)13/h2-4H,5H2,1H3 |
| InChIKey | YEZTUZOSIQKBHJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|