C9H10FNO4 — CID 143031734
ethyl (2Z)-2-(1-fluoroethenyl)-4-nitropenta-2,4-dienoate (PubChem CID 143031734) has the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-fluoroethenyl)-4-nitropenta-2,4-dienoate.
| Compound Name | ethyl (2Z)-2-(1-fluoroethenyl)-4-nitropenta-2,4-dienoate |
|---|---|
| PubChem CID | 143031734 |
| Molecular Formula | C9H10FNO4 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | ethyl (2Z)-2-(1-fluoroethenyl)-4-nitropenta-2,4-dienoate |
| SMILES | C=C(F)/C(=C\C(=C)[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C9H10FNO4/c1-4-15-9(12)8(7(3)10)5-6(2)11(13)14/h5H,2-4H2,1H3/b8-5+ |
| InChIKey | HISPLJPDKZKBSO-VMPITWQZSA-N |
| XLogP | 1.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|