C9H17N3O — CID 144787341
1-(3-aminoprop-1-en-2-yl)piperidine-2-carboxamide (PubChem CID 144787341) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(3-aminoprop-1-en-2-yl)piperidine-2-carboxamide.
| Compound Name | 1-(3-aminoprop-1-en-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 144787341 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(3-aminoprop-1-en-2-yl)piperidine-2-carboxamide |
| SMILES | C=C(CN)N1CCCCC1C(N)=O |
| InChI | InChI=1S/C9H17N3O/c1-7(6-10)12-5-3-2-4-8(12)9(11)13/h8H,1-6,10H2,(H2,11,13) |
| InChIKey | UAOUGPUDCAMFTI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |