C21H24BrN5O3 — CID 144789218
(Z)-3-bromo-2-methyl-3-[1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]ethenoxy]prop-2-enamide (PubChem CID 144789218) has the molecular formula C21H24BrN5O3 and a molecular weight of 474.36 g/mol. Its IUPAC name is (Z)-3-bromo-2-methyl-3-[1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]ethenoxy]prop-2-enamide.
| Compound Name | (Z)-3-bromo-2-methyl-3-[1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]ethenoxy]prop-2-enamide |
|---|---|
| PubChem CID | 144789218 |
| Molecular Formula | C21H24BrN5O3 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (Z)-3-bromo-2-methyl-3-[1-[(6R)-6-methyl-1-[2-(triazol-2-yl)benzoyl]piperidin-3-yl]ethenoxy]prop-2-enamide |
| SMILES | C=C(O/C(Br)=C(\C)C(N)=O)C1CC[C@@H](C)N(C(=O)c2ccccc2-n2nccn2)C1 |
| InChI | InChI=1S/C21H24BrN5O3/c1-13-8-9-16(15(3)30-19(22)14(2)20(23)28)12-26(13)21(29)17-6-4-5-7-18(17)27-24-10-11-25-27/h4-7,10-11,13,16H,3,8-9,12H2,1-2H3,(H2,23,28)/b19-14+/t13-,16?/m1/s1 |
| InChIKey | TXCHRDRLERHNJG-UIYMVDQDSA-N |
| XLogP | 3.15 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|