C14H21FOS — CID 144792013
2-ethyl-4-fluoro-1,3-dimethyl-5-(3-methylsulfanylpropoxy)benzene (PubChem CID 144792013) has the molecular formula C14H21FOS and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-1,3-dimethyl-5-(3-methylsulfanylpropoxy)benzene.
| Compound Name | 2-ethyl-4-fluoro-1,3-dimethyl-5-(3-methylsulfanylpropoxy)benzene |
|---|---|
| PubChem CID | 144792013 |
| Molecular Formula | C14H21FOS |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-ethyl-4-fluoro-1,3-dimethyl-5-(3-methylsulfanylpropoxy)benzene |
| SMILES | CCc1c(C)cc(OCCCSC)c(F)c1C |
| InChI | InChI=1S/C14H21FOS/c1-5-12-10(2)9-13(14(15)11(12)3)16-7-6-8-17-4/h9H,5-8H2,1-4H3 |
| InChIKey | COILFDRDKSVHIZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|