C32H39NO5 — CID 144792235
6-[[4-(4-butoxy-2,6-dimethylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydrofuro[3,2-c]pyridine;ethyl acetate (PubChem CID 144792235) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is 6-[[4-(4-butoxy-2,6-dimethylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydrofuro[3,2-c]pyridine;ethyl acetate.
| Compound Name | 6-[[4-(4-butoxy-2,6-dimethylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydrofuro[3,2-c]pyridine;ethyl acetate |
|---|---|
| PubChem CID | 144792235 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 6-[[4-(4-butoxy-2,6-dimethylphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydrofuro[3,2-c]pyridine;ethyl acetate |
| SMILES | CCCCOc1cc(C)c(-c2cccc3c2CCC3Oc2cc3c(cn2)CCO3)c(C)c1.CCOC(C)=O |
| InChI | InChI=1S/C28H31NO3.C4H8O2/c1-4-5-12-30-21-14-18(2)28(19(3)15-21)24-8-6-7-23-22(24)9-10-25(23)32-27-16-26-20(17-29-27)11-13-31-26;1-3-6-4(2)5/h6-8,14-17,25H,4-5,9-13H2,1-3H3;3H2,1-2H3 |
| InChIKey | RGKPAGVMTIHYIJ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|