methyl 2-(methylideneamino)-2-methyliminoacetate

C5H8N2O2 — CID 144794010

IUPACmethyl 2-(methylideneamino)-2-methyliminoacetate
SMILESC=N/C(=N\C)C(=O)OC
InChIInChI=1S/C5H8N2O2/c1-6-4(7-2)5(8)9-3/h1H2,2-3H3/b7-4-
InChIKeyTXAXASFTANZITR-DAXSKMNVSA-N
MW128.13 g/mol
LogP-0.11
Rot. Bonds

About methyl 2-(methylideneamino)-2-methyliminoacetate

methyl 2-(methylideneamino)-2-methyliminoacetate (PubChem CID 144794010) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is methyl 2-(methylideneamino)-2-methyliminoacetate.

Molecular Properties

Compound Namemethyl 2-(methylideneamino)-2-methyliminoacetate
PubChem CID144794010
Molecular FormulaC5H8N2O2
Molecular Weight128.13 g/mol
Exact Mass128.06
IUPAC Namemethyl 2-(methylideneamino)-2-methyliminoacetate
SMILESC=N/C(=N\C)C(=O)OC
InChIInChI=1S/C5H8N2O2/c1-6-4(7-2)5(8)9-3/h1H2,2-3H3/b7-4-
InChIKeyTXAXASFTANZITR-DAXSKMNVSA-N
XLogP-0.11
TPSA51.02 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.13
LogP ≤ 5-0.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze methyl 2-(methylideneamino)-2-methyliminoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(methylideneamino)-2-methyliminoacetate?
The IUPAC name of methyl 2-(methylideneamino)-2-methyliminoacetate (CID 144794010) is methyl 2-(methylideneamino)-2-methyliminoacetate.
What is the SMILES notation for methyl 2-(methylideneamino)-2-methyliminoacetate?
The canonical SMILES for methyl 2-(methylideneamino)-2-methyliminoacetate is C=N/C(=N\C)C(=O)OC.
What is the InChIKey of methyl 2-(methylideneamino)-2-methyliminoacetate?
The InChIKey is TXAXASFTANZITR-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-6-4(7-2)5(8)9-3/h1H2,2-3H3/b7-4-.
What are the key properties of methyl 2-(methylideneamino)-2-methyliminoacetate?
methyl 2-(methylideneamino)-2-methyliminoacetate has a molecular weight of 128.13 g/mol, XLogP of -0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methylideneamino)-2-methyliminoacetate is sourced from PubChem (CID 144794010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).