C24H27NO4S — CID 144794500
4-[[2-methoxy-5-methyl-4-(2-nitroethyl)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)thiophene (PubChem CID 144794500) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 4-[[2-methoxy-5-methyl-4-(2-nitroethyl)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)thiophene.
| Compound Name | 4-[[2-methoxy-5-methyl-4-(2-nitroethyl)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)thiophene |
|---|---|
| PubChem CID | 144794500 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4-[[2-methoxy-5-methyl-4-(2-nitroethyl)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)thiophene |
| SMILES | COc1cc(CC[N+](=O)[O-])c(C)cc1Cc1csc(-c2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C24H27NO4S/c1-16(2)29-22-7-5-19(6-8-22)24-13-18(15-30-24)12-21-11-17(3)20(9-10-25(26)27)14-23(21)28-4/h5-8,11,13-16H,9-10,12H2,1-4H3 |
| InChIKey | SKMHWTFJOQFINA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|