About 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate
1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate (PubChem CID 144851527) has the molecular formula C14H17F2NO7
and a molecular weight of 349.29 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate.
Molecular Properties
| Compound Name | 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate |
| PubChem CID | 144851527 |
| Molecular Formula | C14H17F2NO7 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate |
| SMILES | COC(=O)CC(=O)OC.O=[N+]([O-])CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C9H9F2NO3.C5H8O4/c10-9(11)15-8-3-1-7(2-4-8)5-6-12(13)14;1-8-4(6)3-5(7)9-2/h1-4,9H,5-6H2;3H2,1-2H3 |
| InChIKey | JJKGVBRVCHELEL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate?
The IUPAC name of 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate (CID 144851527) is 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate.
What is the SMILES notation for 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate?
The canonical SMILES for 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate is COC(=O)CC(=O)OC.O=[N+]([O-])CCc1ccc(OC(F)F)cc1.
What is the InChIKey of 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate?
The InChIKey is JJKGVBRVCHELEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO3.C5H8O4/c10-9(11)15-8-3-1-7(2-4-8)5-6-12(13)14;1-8-4(6)3-5(7)9-2/h1-4,9H,5-6H2;3H2,1-2H3.
What are the key properties of 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate?
1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate has a molecular weight of 349.29 g/mol, XLogP of 1.83, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethoxy)-4-(2-nitroethyl)benzene;dimethyl propanedioate is sourced from PubChem (CID 144851527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).