C18H16F2N2O6 — CID 9112906
methyl 3-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoyl]-5-nitrobenzoate (PubChem CID 9112906) has the molecular formula C18H16F2N2O6 and a molecular weight of 394.33 g/mol. Its IUPAC name is methyl 3-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 9112906 |
| Molecular Formula | C18H16F2N2O6 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | methyl 3-[2-[4-(difluoromethoxy)phenyl]ethylcarbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NCCc2ccc(OC(F)F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16F2N2O6/c1-27-17(24)13-8-12(9-14(10-13)22(25)26)16(23)21-7-6-11-2-4-15(5-3-11)28-18(19)20/h2-5,8-10,18H,6-7H2,1H3,(H,21,23) |
| InChIKey | JFIFAKKXRBORPL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|