C21H25NO2S — CID 144794626
2-(cyclohexen-1-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene (PubChem CID 144794626) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene.
| Compound Name | 2-(cyclohexen-1-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 144794626 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]thiophene |
| SMILES | Cc1cc(Cc2csc(C3=CCCCC3)c2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C21H25NO2S/c1-15-11-20(16(2)10-19(15)8-9-22(23)24)12-17-13-21(25-14-17)18-6-4-3-5-7-18/h6,10-11,13-14H,3-5,7-9,12H2,1-2H3 |
| InChIKey | UIVMJLNOTPWOAH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|